About ethyl 6-oxo-1,7-dihydropyrazolo[5,4-b]pyridine-5-carboxylate
ethyl 6-oxo-1,7-dihydropyrazolo[5,4-b]pyridine-5-carboxylate (PubChem CID 154729406) has the molecular formula C9H9N3O3
and a molecular weight of 207.19 g/mol. Its IUPAC name is ethyl 6-oxo-1,7-dihydropyrazolo[5,4-b]pyridine-5-carboxylate.
Analyze ethyl 6-oxo-1,7-dihydropyrazolo[5,4-b]pyridine-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 6-oxo-1,7-dihydropyrazolo[5,4-b]pyridine-5-carboxylate?
The IUPAC name of ethyl 6-oxo-1,7-dihydropyrazolo[5,4-b]pyridine-5-carboxylate (CID 154729406) is ethyl 6-oxo-1,7-dihydropyrazolo[5,4-b]pyridine-5-carboxylate.
What is the SMILES notation for ethyl 6-oxo-1,7-dihydropyrazolo[5,4-b]pyridine-5-carboxylate?
The canonical SMILES for ethyl 6-oxo-1,7-dihydropyrazolo[5,4-b]pyridine-5-carboxylate is CCOC(=O)c1cc2cn[nH]c2[nH]c1=O.
What is the InChIKey of ethyl 6-oxo-1,7-dihydropyrazolo[5,4-b]pyridine-5-carboxylate?
The InChIKey is BBLLVLRQSUKBEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3O3/c1-2-15-9(14)6-3-5-4-10-12-7(5)11-8(6)13/h3-4H,2H2,1H3,(H2,10,11,12,13).
What are the key properties of ethyl 6-oxo-1,7-dihydropyrazolo[5,4-b]pyridine-5-carboxylate?
ethyl 6-oxo-1,7-dihydropyrazolo[5,4-b]pyridine-5-carboxylate has a molecular weight of 207.19 g/mol, XLogP of 0.43, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 6-oxo-1,7-dihydropyrazolo[5,4-b]pyridine-5-carboxylate is sourced from PubChem (CID 154729406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).