C12H9NO5 — CID 121003181
ethyl 2,5,8-trioxo-1H-quinoline-3-carboxylate (PubChem CID 121003181) has the molecular formula C12H9NO5 and a molecular weight of 247.21 g/mol. Its IUPAC name is ethyl 2,5,8-trioxo-1H-quinoline-3-carboxylate.
| Compound Name | ethyl 2,5,8-trioxo-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 121003181 |
| Molecular Formula | C12H9NO5 |
| Molecular Weight | 247.21 g/mol |
| Exact Mass | 247.05 |
| IUPAC Name | ethyl 2,5,8-trioxo-1H-quinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cc2c([nH]c1=O)C(=O)C=CC2=O |
| InChI | InChI=1S/C12H9NO5/c1-2-18-12(17)7-5-6-8(14)3-4-9(15)10(6)13-11(7)16/h3-5H,2H2,1H3,(H,13,16) |
| InChIKey | QYMSMUBAFVTXRK-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 93.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.21 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|