C10H11N3O3 — CID 139542716
ethyl 6-methoxy-1H-pyrazolo[5,4-b]pyridine-4-carboxylate (PubChem CID 139542716) has the molecular formula C10H11N3O3 and a molecular weight of 221.22 g/mol. Its IUPAC name is ethyl 6-methoxy-1H-pyrazolo[5,4-b]pyridine-4-carboxylate.
| Compound Name | ethyl 6-methoxy-1H-pyrazolo[5,4-b]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 139542716 |
| Molecular Formula | C10H11N3O3 |
| Molecular Weight | 221.22 g/mol |
| Exact Mass | 221.08 |
| IUPAC Name | ethyl 6-methoxy-1H-pyrazolo[5,4-b]pyridine-4-carboxylate |
| SMILES | CCOC(=O)c1cc(OC)nc2[nH]ncc12 |
| InChI | InChI=1S/C10H11N3O3/c1-3-16-10(14)6-4-8(15-2)12-9-7(6)5-11-13-9/h4-5H,3H2,1-2H3,(H,11,12,13) |
| InChIKey | BPTCURSIUYQCEC-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.22 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |