C34H30O8 — CID 102587612
tetraethyl pentacene-2,3,9,10-tetracarboxylate (PubChem CID 102587612) has the molecular formula C34H30O8 and a molecular weight of 566.61 g/mol. Its IUPAC name is tetraethyl pentacene-2,3,9,10-tetracarboxylate.
| Compound Name | tetraethyl pentacene-2,3,9,10-tetracarboxylate |
|---|---|
| PubChem CID | 102587612 |
| Molecular Formula | C34H30O8 |
| Molecular Weight | 566.61 g/mol |
| Exact Mass | 566.19 |
| IUPAC Name | tetraethyl pentacene-2,3,9,10-tetracarboxylate |
| SMILES | CCOC(=O)c1cc2cc3cc4cc5cc(C(=O)OCC)c(C(=O)OCC)cc5cc4cc3cc2cc1C(=O)OCC |
| InChI | InChI=1S/C34H30O8/c1-5-39-31(35)27-15-23-11-19-9-21-13-25-17-29(33(37)41-7-3)30(34(38)42-8-4)18-26(25)14-22(21)10-20(19)12-24(23)16-28(27)32(36)40-6-2/h9-18H,5-8H2,1-4H3 |
| InChIKey | CATLWASQVOKWEJ-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.61 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|