C9H7Br3O2 — CID 112694304
ethyl 2,3,5-tribromobenzoate (PubChem CID 112694304) has the molecular formula C9H7Br3O2 and a molecular weight of 386.87 g/mol. Its IUPAC name is ethyl 2,3,5-tribromobenzoate.
| Compound Name | ethyl 2,3,5-tribromobenzoate |
|---|---|
| PubChem CID | 112694304 |
| Molecular Formula | C9H7Br3O2 |
| Molecular Weight | 386.87 g/mol |
| Exact Mass | 383.80 |
| IUPAC Name | ethyl 2,3,5-tribromobenzoate |
| SMILES | CCOC(=O)c1cc(Br)cc(Br)c1Br |
| InChI | InChI=1S/C9H7Br3O2/c1-2-14-9(13)6-3-5(10)4-7(11)8(6)12/h3-4H,2H2,1H3 |
| InChIKey | WGNTXHOLFMEPSG-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.87 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|