C26H20O4S3 — CID 44556988
diethyl 1,3-dithiophen-2-ylbenzo[f][2]benzothiole-6,7-dicarboxylate (PubChem CID 44556988) has the molecular formula C26H20O4S3 and a molecular weight of 492.64 g/mol. Its IUPAC name is diethyl 1,3-dithiophen-2-ylbenzo[f][2]benzothiole-6,7-dicarboxylate.
| Compound Name | diethyl 1,3-dithiophen-2-ylbenzo[f][2]benzothiole-6,7-dicarboxylate |
|---|---|
| PubChem CID | 44556988 |
| Molecular Formula | C26H20O4S3 |
| Molecular Weight | 492.64 g/mol |
| Exact Mass | 492.05 |
| IUPAC Name | diethyl 1,3-dithiophen-2-ylbenzo[f][2]benzothiole-6,7-dicarboxylate |
| SMILES | CCOC(=O)c1cc2cc3c(-c4cccs4)sc(-c4cccs4)c3cc2cc1C(=O)OCC |
| InChI | InChI=1S/C26H20O4S3/c1-3-29-25(27)19-13-15-11-17-18(12-16(15)14-20(19)26(28)30-4-2)24(22-8-6-10-32-22)33-23(17)21-7-5-9-31-21/h5-14H,3-4H2,1-2H3 |
| InChIKey | ROPPBTKWEZYNCX-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.64 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |