C20H18N2O6S3 — CID 101036688
ethyl 2-[[4-[(2-ethoxy-2-oxoacetyl)amino]-2,5-dithiophen-2-ylthiophen-3-yl]amino]-2-oxoacetate (PubChem CID 101036688) has the molecular formula C20H18N2O6S3 and a molecular weight of 478.57 g/mol. Its IUPAC name is ethyl 2-[[4-[(2-ethoxy-2-oxoacetyl)amino]-2,5-dithiophen-2-ylthiophen-3-yl]amino]-2-oxoacetate.
| Compound Name | ethyl 2-[[4-[(2-ethoxy-2-oxoacetyl)amino]-2,5-dithiophen-2-ylthiophen-3-yl]amino]-2-oxoacetate |
|---|---|
| PubChem CID | 101036688 |
| Molecular Formula | C20H18N2O6S3 |
| Molecular Weight | 478.57 g/mol |
| Exact Mass | 478.03 |
| IUPAC Name | ethyl 2-[[4-[(2-ethoxy-2-oxoacetyl)amino]-2,5-dithiophen-2-ylthiophen-3-yl]amino]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)Nc1c(-c2cccs2)sc(-c2cccs2)c1NC(=O)C(=O)OCC |
| InChI | InChI=1S/C20H18N2O6S3/c1-3-27-19(25)17(23)21-13-14(22-18(24)20(26)28-4-2)16(12-8-6-10-30-12)31-15(13)11-7-5-9-29-11/h5-10H,3-4H2,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | CQNKCLFFCAMHRJ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.57 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|