C12H12Cl3NO3 — CID 121390092
ethyl 3-(2,2,2-trichloroacetyl)-6,7-dihydro-5H-pyrrolizine-1-carboxylate (PubChem CID 121390092) has the molecular formula C12H12Cl3NO3 and a molecular weight of 324.59 g/mol. Its IUPAC name is ethyl 3-(2,2,2-trichloroacetyl)-6,7-dihydro-5H-pyrrolizine-1-carboxylate.
| Compound Name | ethyl 3-(2,2,2-trichloroacetyl)-6,7-dihydro-5H-pyrrolizine-1-carboxylate |
|---|---|
| PubChem CID | 121390092 |
| Molecular Formula | C12H12Cl3NO3 |
| Molecular Weight | 324.59 g/mol |
| Exact Mass | 322.99 |
| IUPAC Name | ethyl 3-(2,2,2-trichloroacetyl)-6,7-dihydro-5H-pyrrolizine-1-carboxylate |
| SMILES | CCOC(=O)c1cc(C(=O)C(Cl)(Cl)Cl)n2c1CCC2 |
| InChI | InChI=1S/C12H12Cl3NO3/c1-2-19-11(18)7-6-9(10(17)12(13,14)15)16-5-3-4-8(7)16/h6H,2-5H2,1H3 |
| InChIKey | LPAKTQYEBLBXQQ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.59 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|