C15H18N2O6 — CID 177476049
ethyl (9Z)-9-(2-ethoxy-1-hydroxy-2-oxoethylidene)-4-oxo-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-3-carboxylate (PubChem CID 177476049) has the molecular formula C15H18N2O6 and a molecular weight of 322.32 g/mol. Its IUPAC name is ethyl (9Z)-9-(2-ethoxy-1-hydroxy-2-oxoethylidene)-4-oxo-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-3-carboxylate.
| Compound Name | ethyl (9Z)-9-(2-ethoxy-1-hydroxy-2-oxoethylidene)-4-oxo-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-3-carboxylate |
|---|---|
| PubChem CID | 177476049 |
| Molecular Formula | C15H18N2O6 |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | ethyl (9Z)-9-(2-ethoxy-1-hydroxy-2-oxoethylidene)-4-oxo-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-3-carboxylate |
| SMILES | CCOC(=O)/C(O)=C1\CCCn2c1ncc(C(=O)OCC)c2=O |
| InChI | InChI=1S/C15H18N2O6/c1-3-22-14(20)10-8-16-12-9(11(18)15(21)23-4-2)6-5-7-17(12)13(10)19/h8,18H,3-7H2,1-2H3/b11-9- |
| InChIKey | QKHQQFDJIAZQNW-LUAWRHEFSA-N |
| XLogP | 1.05 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|