About ethyl 2-chloro-5,6,7,8-tetrahydroindolizine-3-carboxylate
ethyl 2-chloro-5,6,7,8-tetrahydroindolizine-3-carboxylate (PubChem CID 146496064) has the molecular formula C11H14ClNO2
and a molecular weight of 227.69 g/mol. Its IUPAC name is ethyl 2-chloro-5,6,7,8-tetrahydroindolizine-3-carboxylate.
Analyze ethyl 2-chloro-5,6,7,8-tetrahydroindolizine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-chloro-5,6,7,8-tetrahydroindolizine-3-carboxylate?
The IUPAC name of ethyl 2-chloro-5,6,7,8-tetrahydroindolizine-3-carboxylate (CID 146496064) is ethyl 2-chloro-5,6,7,8-tetrahydroindolizine-3-carboxylate.
What is the SMILES notation for ethyl 2-chloro-5,6,7,8-tetrahydroindolizine-3-carboxylate?
The canonical SMILES for ethyl 2-chloro-5,6,7,8-tetrahydroindolizine-3-carboxylate is CCOC(=O)c1c(Cl)cc2n1CCCC2.
What is the InChIKey of ethyl 2-chloro-5,6,7,8-tetrahydroindolizine-3-carboxylate?
The InChIKey is MHEJKDKFLZVJAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14ClNO2/c1-2-15-11(14)10-9(12)7-8-5-3-4-6-13(8)10/h7H,2-6H2,1H3.
What are the key properties of ethyl 2-chloro-5,6,7,8-tetrahydroindolizine-3-carboxylate?
ethyl 2-chloro-5,6,7,8-tetrahydroindolizine-3-carboxylate has a molecular weight of 227.69 g/mol, XLogP of 2.65, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-chloro-5,6,7,8-tetrahydroindolizine-3-carboxylate is sourced from PubChem (CID 146496064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).