C11H15NO2 — CID 122223917
ethyl 5,6,7,8-tetrahydroindolizine-2-carboxylate (PubChem CID 122223917) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is ethyl 5,6,7,8-tetrahydroindolizine-2-carboxylate.
| Compound Name | ethyl 5,6,7,8-tetrahydroindolizine-2-carboxylate |
|---|---|
| PubChem CID | 122223917 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | ethyl 5,6,7,8-tetrahydroindolizine-2-carboxylate |
| SMILES | CCOC(=O)c1cc2n(c1)CCCC2 |
| InChI | InChI=1S/C11H15NO2/c1-2-14-11(13)9-7-10-5-3-4-6-12(10)8-9/h7-8H,2-6H2,1H3 |
| InChIKey | CYNUEPFNNVNJQR-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |