C21H26N2O4 — CID 160664243
2-O-[(3,5-dimethylphenyl)methyl] 8-O-ethyl 1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepine-2,8-dicarboxylate (PubChem CID 160664243) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is 2-O-[(3,5-dimethylphenyl)methyl] 8-O-ethyl 1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepine-2,8-dicarboxylate.
| Compound Name | 2-O-[(3,5-dimethylphenyl)methyl] 8-O-ethyl 1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepine-2,8-dicarboxylate |
|---|---|
| PubChem CID | 160664243 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | 2-O-[(3,5-dimethylphenyl)methyl] 8-O-ethyl 1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepine-2,8-dicarboxylate |
| SMILES | CCOC(=O)c1cc2n(c1)CCCN(C(=O)OCc1cc(C)cc(C)c1)C2 |
| InChI | InChI=1S/C21H26N2O4/c1-4-26-20(24)18-11-19-13-23(7-5-6-22(19)12-18)21(25)27-14-17-9-15(2)8-16(3)10-17/h8-12H,4-7,13-14H2,1-3H3 |
| InChIKey | RMBQKRITHQNLPP-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 60.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |