C13H15FN2O3 — CID 166417590
ethyl 2-(2-fluoroprop-2-enoyl)-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-7-carboxylate (PubChem CID 166417590) has the molecular formula C13H15FN2O3 and a molecular weight of 266.27 g/mol. Its IUPAC name is ethyl 2-(2-fluoroprop-2-enoyl)-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-7-carboxylate.
| Compound Name | ethyl 2-(2-fluoroprop-2-enoyl)-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-7-carboxylate |
|---|---|
| PubChem CID | 166417590 |
| Molecular Formula | C13H15FN2O3 |
| Molecular Weight | 266.27 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | ethyl 2-(2-fluoroprop-2-enoyl)-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-7-carboxylate |
| SMILES | C=C(F)C(=O)N1CCn2cc(C(=O)OCC)cc2C1 |
| InChI | InChI=1S/C13H15FN2O3/c1-3-19-13(18)10-6-11-8-16(12(17)9(2)14)5-4-15(11)7-10/h6-7H,2-5,8H2,1H3 |
| InChIKey | IIWZKOSPHHWAPZ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.27 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|