C11H15NO5 — CID 164676176
ethyl 6-(ethoxymethyl)-4-hydroxy-2-oxo-1H-pyridine-3-carboxylate (PubChem CID 164676176) has the molecular formula C11H15NO5 and a molecular weight of 241.24 g/mol. Its IUPAC name is ethyl 6-(ethoxymethyl)-4-hydroxy-2-oxo-1H-pyridine-3-carboxylate.
| Compound Name | ethyl 6-(ethoxymethyl)-4-hydroxy-2-oxo-1H-pyridine-3-carboxylate |
|---|---|
| PubChem CID | 164676176 |
| Molecular Formula | C11H15NO5 |
| Molecular Weight | 241.24 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | ethyl 6-(ethoxymethyl)-4-hydroxy-2-oxo-1H-pyridine-3-carboxylate |
| SMILES | CCOCc1cc(O)c(C(=O)OCC)c(=O)[nH]1 |
| InChI | InChI=1S/C11H15NO5/c1-3-16-6-7-5-8(13)9(10(14)12-7)11(15)17-4-2/h5H,3-4,6H2,1-2H3,(H2,12,13,14) |
| InChIKey | HZNNOWOHJZMSGE-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 88.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.24 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |