C10H13NO4 — CID 54738298
ethyl 6-ethyl-4-hydroxy-2-oxo-1H-pyridine-3-carboxylate (PubChem CID 54738298) has the molecular formula C10H13NO4 and a molecular weight of 211.22 g/mol. Its IUPAC name is ethyl 6-ethyl-4-hydroxy-2-oxo-1H-pyridine-3-carboxylate.
| Compound Name | ethyl 6-ethyl-4-hydroxy-2-oxo-1H-pyridine-3-carboxylate |
|---|---|
| PubChem CID | 54738298 |
| Molecular Formula | C10H13NO4 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | ethyl 6-ethyl-4-hydroxy-2-oxo-1H-pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1c(O)cc(CC)[nH]c1=O |
| InChI | InChI=1S/C10H13NO4/c1-3-6-5-7(12)8(9(13)11-6)10(14)15-4-2/h5H,3-4H2,1-2H3,(H2,11,12,13) |
| InChIKey | PGNSACFZBNJZGY-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 79.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |