C9H14N2O5 — CID 90856246
acetic acid;ethyl 2-methyl-3-oxo-1H-pyrazole-5-carboxylate (PubChem CID 90856246) has the molecular formula C9H14N2O5 and a molecular weight of 230.22 g/mol. Its IUPAC name is acetic acid;ethyl 2-methyl-3-oxo-1H-pyrazole-5-carboxylate.
| Compound Name | acetic acid;ethyl 2-methyl-3-oxo-1H-pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 90856246 |
| Molecular Formula | C9H14N2O5 |
| Molecular Weight | 230.22 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | acetic acid;ethyl 2-methyl-3-oxo-1H-pyrazole-5-carboxylate |
| SMILES | CC(=O)O.CCOC(=O)c1cc(=O)n(C)[nH]1 |
| InChI | InChI=1S/C7H10N2O3.C2H4O2/c1-3-12-7(11)5-4-6(10)9(2)8-5;1-2(3)4/h4,8H,3H2,1-2H3;1H3,(H,3,4) |
| InChIKey | YFAXQPIHUYYUCL-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 101.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.22 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |