C12H10Cl2N2O3 — CID 23330093
ethyl 2-(3,4-dichlorophenyl)-3-oxo-1H-pyrazole-5-carboxylate (PubChem CID 23330093) has the molecular formula C12H10Cl2N2O3 and a molecular weight of 301.13 g/mol. Its IUPAC name is ethyl 2-(3,4-dichlorophenyl)-3-oxo-1H-pyrazole-5-carboxylate.
| Compound Name | ethyl 2-(3,4-dichlorophenyl)-3-oxo-1H-pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 23330093 |
| Molecular Formula | C12H10Cl2N2O3 |
| Molecular Weight | 301.13 g/mol |
| Exact Mass | 300.01 |
| IUPAC Name | ethyl 2-(3,4-dichlorophenyl)-3-oxo-1H-pyrazole-5-carboxylate |
| SMILES | CCOC(=O)c1cc(=O)n(-c2ccc(Cl)c(Cl)c2)[nH]1 |
| InChI | InChI=1S/C12H10Cl2N2O3/c1-2-19-12(18)10-6-11(17)16(15-10)7-3-4-8(13)9(14)5-7/h3-6,15H,2H2,1H3 |
| InChIKey | FZLIMGPHATYPGA-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.13 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |