C11H9Cl2N3O2 — CID 122241367
ethyl 1-(3,4-dichlorophenyl)triazole-4-carboxylate (PubChem CID 122241367) has the molecular formula C11H9Cl2N3O2 and a molecular weight of 286.12 g/mol. Its IUPAC name is ethyl 1-(3,4-dichlorophenyl)triazole-4-carboxylate.
| Compound Name | ethyl 1-(3,4-dichlorophenyl)triazole-4-carboxylate |
|---|---|
| PubChem CID | 122241367 |
| Molecular Formula | C11H9Cl2N3O2 |
| Molecular Weight | 286.12 g/mol |
| Exact Mass | 285.01 |
| IUPAC Name | ethyl 1-(3,4-dichlorophenyl)triazole-4-carboxylate |
| SMILES | CCOC(=O)c1cn(-c2ccc(Cl)c(Cl)c2)nn1 |
| InChI | InChI=1S/C11H9Cl2N3O2/c1-2-18-11(17)10-6-16(15-14-10)7-3-4-8(12)9(13)5-7/h3-6H,2H2,1H3 |
| InChIKey | CPYMSLLAYSUFLO-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.12 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |