C23H21Cl2N3O5 — CID 3801688
ethyl 4-[4-[2-[(2,4-dichlorophenyl)methyl]-3-ethoxy-3-oxopropanoyl]triazol-1-yl]benzoate (PubChem CID 3801688) has the molecular formula C23H21Cl2N3O5 and a molecular weight of 490.34 g/mol. Its IUPAC name is ethyl 4-[4-[2-[(2,4-dichlorophenyl)methyl]-3-ethoxy-3-oxopropanoyl]triazol-1-yl]benzoate.
| Compound Name | ethyl 4-[4-[2-[(2,4-dichlorophenyl)methyl]-3-ethoxy-3-oxopropanoyl]triazol-1-yl]benzoate |
|---|---|
| PubChem CID | 3801688 |
| Molecular Formula | C23H21Cl2N3O5 |
| Molecular Weight | 490.34 g/mol |
| Exact Mass | 489.09 |
| IUPAC Name | ethyl 4-[4-[2-[(2,4-dichlorophenyl)methyl]-3-ethoxy-3-oxopropanoyl]triazol-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(-n2cc(C(=O)C(Cc3ccc(Cl)cc3Cl)C(=O)OCC)nn2)cc1 |
| InChI | InChI=1S/C23H21Cl2N3O5/c1-3-32-22(30)14-6-9-17(10-7-14)28-13-20(26-27-28)21(29)18(23(31)33-4-2)11-15-5-8-16(24)12-19(15)25/h5-10,12-13,18H,3-4,11H2,1-2H3 |
| InChIKey | SABIAJQQXQARDD-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 100.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.34 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|