C16H10Cl3N3O2 — CID 1475816
[1-(4-chlorophenyl)triazol-4-yl]methyl 2,4-dichlorobenzoate (PubChem CID 1475816) has the molecular formula C16H10Cl3N3O2 and a molecular weight of 382.63 g/mol. Its IUPAC name is [1-(4-chlorophenyl)triazol-4-yl]methyl 2,4-dichlorobenzoate.
| Compound Name | [1-(4-chlorophenyl)triazol-4-yl]methyl 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 1475816 |
| Molecular Formula | C16H10Cl3N3O2 |
| Molecular Weight | 382.63 g/mol |
| Exact Mass | 380.98 |
| IUPAC Name | [1-(4-chlorophenyl)triazol-4-yl]methyl 2,4-dichlorobenzoate |
| SMILES | O=C(OCc1cn(-c2ccc(Cl)cc2)nn1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H10Cl3N3O2/c17-10-1-4-13(5-2-10)22-8-12(20-21-22)9-24-16(23)14-6-3-11(18)7-15(14)19/h1-8H,9H2 |
| InChIKey | LBBCYPBBUXIPMQ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.63 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |