C13H14ClN3O4 — CID 122241457
ethyl 1-(5-chloro-2,4-dimethoxyphenyl)triazole-4-carboxylate (PubChem CID 122241457) has the molecular formula C13H14ClN3O4 and a molecular weight of 311.73 g/mol. Its IUPAC name is ethyl 1-(5-chloro-2,4-dimethoxyphenyl)triazole-4-carboxylate.
| Compound Name | ethyl 1-(5-chloro-2,4-dimethoxyphenyl)triazole-4-carboxylate |
|---|---|
| PubChem CID | 122241457 |
| Molecular Formula | C13H14ClN3O4 |
| Molecular Weight | 311.73 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | ethyl 1-(5-chloro-2,4-dimethoxyphenyl)triazole-4-carboxylate |
| SMILES | CCOC(=O)c1cn(-c2cc(Cl)c(OC)cc2OC)nn1 |
| InChI | InChI=1S/C13H14ClN3O4/c1-4-21-13(18)9-7-17(16-15-9)10-5-8(14)11(19-2)6-12(10)20-3/h5-7H,4H2,1-3H3 |
| InChIKey | LDMJPNFXUVNLON-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 75.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.73 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |