C11H10ClN3O3 — CID 122241271
1-(5-chloro-2,4-dimethoxyphenyl)triazole-4-carbaldehyde (PubChem CID 122241271) has the molecular formula C11H10ClN3O3 and a molecular weight of 267.67 g/mol. Its IUPAC name is 1-(5-chloro-2,4-dimethoxyphenyl)triazole-4-carbaldehyde.
| Compound Name | 1-(5-chloro-2,4-dimethoxyphenyl)triazole-4-carbaldehyde |
|---|---|
| PubChem CID | 122241271 |
| Molecular Formula | C11H10ClN3O3 |
| Molecular Weight | 267.67 g/mol |
| Exact Mass | 267.04 |
| IUPAC Name | 1-(5-chloro-2,4-dimethoxyphenyl)triazole-4-carbaldehyde |
| SMILES | COc1cc(OC)c(-n2cc(C=O)nn2)cc1Cl |
| InChI | InChI=1S/C11H10ClN3O3/c1-17-10-4-11(18-2)9(3-8(10)12)15-5-7(6-16)13-14-15/h3-6H,1-2H3 |
| InChIKey | NBRISWMRJMMINI-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.67 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|