C13H13ClN2O3 — CID 84617560
1-(4-chloro-2,5-dimethoxyphenyl)-3-methylpyrazole-4-carbaldehyde (PubChem CID 84617560) has the molecular formula C13H13ClN2O3 and a molecular weight of 280.71 g/mol. Its IUPAC name is 1-(4-chloro-2,5-dimethoxyphenyl)-3-methylpyrazole-4-carbaldehyde.
| Compound Name | 1-(4-chloro-2,5-dimethoxyphenyl)-3-methylpyrazole-4-carbaldehyde |
|---|---|
| PubChem CID | 84617560 |
| Molecular Formula | C13H13ClN2O3 |
| Molecular Weight | 280.71 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | 1-(4-chloro-2,5-dimethoxyphenyl)-3-methylpyrazole-4-carbaldehyde |
| SMILES | COc1cc(-n2cc(C=O)c(C)n2)c(OC)cc1Cl |
| InChI | InChI=1S/C13H13ClN2O3/c1-8-9(7-17)6-16(15-8)11-5-12(18-2)10(14)4-13(11)19-3/h4-7H,1-3H3 |
| InChIKey | MURDOUROSDQPKP-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.71 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|