About N-[[1-(5-chloro-2,4-dimethoxyphenyl)tetrazol-5-yl]methyl]ethanamine
N-[[1-(5-chloro-2,4-dimethoxyphenyl)tetrazol-5-yl]methyl]ethanamine (PubChem CID 62736289) has the molecular formula C12H16ClN5O2
and a molecular weight of 297.75 g/mol. Its IUPAC name is N-[[1-(5-chloro-2,4-dimethoxyphenyl)tetrazol-5-yl]methyl]ethanamine.
Molecular Properties
| Compound Name | N-[[1-(5-chloro-2,4-dimethoxyphenyl)tetrazol-5-yl]methyl]ethanamine |
| PubChem CID | 62736289 |
| Molecular Formula | C12H16ClN5O2 |
| Molecular Weight | 297.75 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | N-[[1-(5-chloro-2,4-dimethoxyphenyl)tetrazol-5-yl]methyl]ethanamine |
| SMILES | CCNCc1nnnn1-c1cc(Cl)c(OC)cc1OC |
| InChI | InChI=1S/C12H16ClN5O2/c1-4-14-7-12-15-16-17-18(12)9-5-8(13)10(19-2)6-11(9)20-3/h5-6,14H,4,7H2,1-3H3 |
| InChIKey | UMTCVGOQCKBNLG-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.75 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-[[1-(5-chloro-2,4-dimethoxyphenyl)tetrazol-5-yl]methyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[1-(5-chloro-2,4-dimethoxyphenyl)tetrazol-5-yl]methyl]ethanamine?
The IUPAC name of N-[[1-(5-chloro-2,4-dimethoxyphenyl)tetrazol-5-yl]methyl]ethanamine (CID 62736289) is N-[[1-(5-chloro-2,4-dimethoxyphenyl)tetrazol-5-yl]methyl]ethanamine.
What is the SMILES notation for N-[[1-(5-chloro-2,4-dimethoxyphenyl)tetrazol-5-yl]methyl]ethanamine?
The canonical SMILES for N-[[1-(5-chloro-2,4-dimethoxyphenyl)tetrazol-5-yl]methyl]ethanamine is CCNCc1nnnn1-c1cc(Cl)c(OC)cc1OC.
What is the InChIKey of N-[[1-(5-chloro-2,4-dimethoxyphenyl)tetrazol-5-yl]methyl]ethanamine?
The InChIKey is UMTCVGOQCKBNLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16ClN5O2/c1-4-14-7-12-15-16-17-18(12)9-5-8(13)10(19-2)6-11(9)20-3/h5-6,14H,4,7H2,1-3H3.
What are the key properties of N-[[1-(5-chloro-2,4-dimethoxyphenyl)tetrazol-5-yl]methyl]ethanamine?
N-[[1-(5-chloro-2,4-dimethoxyphenyl)tetrazol-5-yl]methyl]ethanamine has a molecular weight of 297.75 g/mol, XLogP of 1.44, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[1-(5-chloro-2,4-dimethoxyphenyl)tetrazol-5-yl]methyl]ethanamine is sourced from PubChem (CID 62736289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).