C14H17N3O4 — CID 122241390
methyl 1-(2,5-diethoxyphenyl)triazole-4-carboxylate (PubChem CID 122241390) has the molecular formula C14H17N3O4 and a molecular weight of 291.31 g/mol. Its IUPAC name is methyl 1-(2,5-diethoxyphenyl)triazole-4-carboxylate.
| Compound Name | methyl 1-(2,5-diethoxyphenyl)triazole-4-carboxylate |
|---|---|
| PubChem CID | 122241390 |
| Molecular Formula | C14H17N3O4 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | methyl 1-(2,5-diethoxyphenyl)triazole-4-carboxylate |
| SMILES | CCOc1ccc(OCC)c(-n2cc(C(=O)OC)nn2)c1 |
| InChI | InChI=1S/C14H17N3O4/c1-4-20-10-6-7-13(21-5-2)12(8-10)17-9-11(15-16-17)14(18)19-3/h6-9H,4-5H2,1-3H3 |
| InChIKey | DGPIRYAZBPTLPZ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 75.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |