C10H11N3O2 — CID 63723819
ethyl 7-methyl-1H-imidazo[4,5-b]pyridine-2-carboxylate (PubChem CID 63723819) has the molecular formula C10H11N3O2 and a molecular weight of 205.22 g/mol. Its IUPAC name is ethyl 7-methyl-1H-imidazo[4,5-b]pyridine-2-carboxylate.
| Compound Name | ethyl 7-methyl-1H-imidazo[4,5-b]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 63723819 |
| Molecular Formula | C10H11N3O2 |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | ethyl 7-methyl-1H-imidazo[4,5-b]pyridine-2-carboxylate |
| SMILES | CCOC(=O)c1nc2nccc(C)c2[nH]1 |
| InChI | InChI=1S/C10H11N3O2/c1-3-15-10(14)9-12-7-6(2)4-5-11-8(7)13-9/h4-5H,3H2,1-2H3,(H,11,12,13) |
| InChIKey | YROSTIKGIHWXNS-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |