About ethyl 2-methyl-7-oxo-6H-[1,3]thiazolo[5,4-d]pyrimidine-5-carboxylate
ethyl 2-methyl-7-oxo-6H-[1,3]thiazolo[5,4-d]pyrimidine-5-carboxylate (PubChem CID 59298245) has the molecular formula C9H9N3O3S
and a molecular weight of 239.26 g/mol. Its IUPAC name is ethyl 2-methyl-7-oxo-6H-[1,3]thiazolo[5,4-d]pyrimidine-5-carboxylate.
Molecular Properties
| Compound Name | ethyl 2-methyl-7-oxo-6H-[1,3]thiazolo[5,4-d]pyrimidine-5-carboxylate |
| PubChem CID | 59298245 |
| Molecular Formula | C9H9N3O3S |
| Molecular Weight | 239.26 g/mol |
| Exact Mass | 239.04 |
| IUPAC Name | ethyl 2-methyl-7-oxo-6H-[1,3]thiazolo[5,4-d]pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1nc2sc(C)nc2c(=O)[nH]1 |
| InChI | InChI=1S/C9H9N3O3S/c1-3-15-9(14)6-11-7(13)5-8(12-6)16-4(2)10-5/h3H2,1-2H3,(H,11,12,13) |
| InChIKey | XISMUXYYQYALGQ-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.26 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 2-methyl-7-oxo-6H-[1,3]thiazolo[5,4-d]pyrimidine-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-methyl-7-oxo-6H-[1,3]thiazolo[5,4-d]pyrimidine-5-carboxylate?
The IUPAC name of ethyl 2-methyl-7-oxo-6H-[1,3]thiazolo[5,4-d]pyrimidine-5-carboxylate (CID 59298245) is ethyl 2-methyl-7-oxo-6H-[1,3]thiazolo[5,4-d]pyrimidine-5-carboxylate.
What is the SMILES notation for ethyl 2-methyl-7-oxo-6H-[1,3]thiazolo[5,4-d]pyrimidine-5-carboxylate?
The canonical SMILES for ethyl 2-methyl-7-oxo-6H-[1,3]thiazolo[5,4-d]pyrimidine-5-carboxylate is CCOC(=O)c1nc2sc(C)nc2c(=O)[nH]1.
What is the InChIKey of ethyl 2-methyl-7-oxo-6H-[1,3]thiazolo[5,4-d]pyrimidine-5-carboxylate?
The InChIKey is XISMUXYYQYALGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3O3S/c1-3-15-9(14)6-11-7(13)5-8(12-6)16-4(2)10-5/h3H2,1-2H3,(H,11,12,13).
What are the key properties of ethyl 2-methyl-7-oxo-6H-[1,3]thiazolo[5,4-d]pyrimidine-5-carboxylate?
ethyl 2-methyl-7-oxo-6H-[1,3]thiazolo[5,4-d]pyrimidine-5-carboxylate has a molecular weight of 239.26 g/mol, XLogP of 0.86, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-methyl-7-oxo-6H-[1,3]thiazolo[5,4-d]pyrimidine-5-carboxylate is sourced from PubChem (CID 59298245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).