C18H26N2O3S — CID 13121508
ethyl 5-methyl-6-octyl-4-oxo-3H-thieno[2,3-d]pyrimidine-2-carboxylate (PubChem CID 13121508) has the molecular formula C18H26N2O3S and a molecular weight of 350.48 g/mol. Its IUPAC name is ethyl 5-methyl-6-octyl-4-oxo-3H-thieno[2,3-d]pyrimidine-2-carboxylate.
| Compound Name | ethyl 5-methyl-6-octyl-4-oxo-3H-thieno[2,3-d]pyrimidine-2-carboxylate |
|---|---|
| PubChem CID | 13121508 |
| Molecular Formula | C18H26N2O3S |
| Molecular Weight | 350.48 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | ethyl 5-methyl-6-octyl-4-oxo-3H-thieno[2,3-d]pyrimidine-2-carboxylate |
| SMILES | CCCCCCCCc1sc2nc(C(=O)OCC)[nH]c(=O)c2c1C |
| InChI | InChI=1S/C18H26N2O3S/c1-4-6-7-8-9-10-11-13-12(3)14-16(21)19-15(18(22)23-5-2)20-17(14)24-13/h4-11H2,1-3H3,(H,19,20,21) |
| InChIKey | GXBZAFTWKIGADP-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.48 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|