C12H12N2O4S — CID 143679539
ethyl 2-(1-hydroxyethenyl)-5-methyl-4-oxo-3H-thieno[2,3-d]pyrimidine-6-carboxylate (PubChem CID 143679539) has the molecular formula C12H12N2O4S and a molecular weight of 280.31 g/mol. Its IUPAC name is ethyl 2-(1-hydroxyethenyl)-5-methyl-4-oxo-3H-thieno[2,3-d]pyrimidine-6-carboxylate.
| Compound Name | ethyl 2-(1-hydroxyethenyl)-5-methyl-4-oxo-3H-thieno[2,3-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 143679539 |
| Molecular Formula | C12H12N2O4S |
| Molecular Weight | 280.31 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | ethyl 2-(1-hydroxyethenyl)-5-methyl-4-oxo-3H-thieno[2,3-d]pyrimidine-6-carboxylate |
| SMILES | C=C(O)c1nc2sc(C(=O)OCC)c(C)c2c(=O)[nH]1 |
| InChI | InChI=1S/C12H12N2O4S/c1-4-18-12(17)8-5(2)7-10(16)13-9(6(3)15)14-11(7)19-8/h15H,3-4H2,1-2H3,(H,13,14,16) |
| InChIKey | QWGMJFADCITQBD-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 92.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.31 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|