C9H7BrN2O2S — CID 70297669
6-bromo-2-(1-hydroxyethenyl)-5-methyl-3H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 70297669) has the molecular formula C9H7BrN2O2S and a molecular weight of 287.14 g/mol. Its IUPAC name is 6-bromo-2-(1-hydroxyethenyl)-5-methyl-3H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 6-bromo-2-(1-hydroxyethenyl)-5-methyl-3H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 70297669 |
| Molecular Formula | C9H7BrN2O2S |
| Molecular Weight | 287.14 g/mol |
| Exact Mass | 285.94 |
| IUPAC Name | 6-bromo-2-(1-hydroxyethenyl)-5-methyl-3H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | C=C(O)c1nc2sc(Br)c(C)c2c(=O)[nH]1 |
| InChI | InChI=1S/C9H7BrN2O2S/c1-3-5-8(14)11-7(4(2)13)12-9(5)15-6(3)10/h13H,2H2,1H3,(H,11,12,14) |
| InChIKey | GFCYPOKINSAZKY-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.14 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|