C12H9N3O2S2 — CID 70299663
2-(1-hydroxyethenyl)-5-(4-methyl-1,3-thiazol-2-yl)-3H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 70299663) has the molecular formula C12H9N3O2S2 and a molecular weight of 291.36 g/mol. Its IUPAC name is 2-(1-hydroxyethenyl)-5-(4-methyl-1,3-thiazol-2-yl)-3H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 2-(1-hydroxyethenyl)-5-(4-methyl-1,3-thiazol-2-yl)-3H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 70299663 |
| Molecular Formula | C12H9N3O2S2 |
| Molecular Weight | 291.36 g/mol |
| Exact Mass | 291.01 |
| IUPAC Name | 2-(1-hydroxyethenyl)-5-(4-methyl-1,3-thiazol-2-yl)-3H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | C=C(O)c1nc2scc(-c3nc(C)cs3)c2c(=O)[nH]1 |
| InChI | InChI=1S/C12H9N3O2S2/c1-5-3-18-11(13-5)7-4-19-12-8(7)10(17)14-9(15-12)6(2)16/h3-4,16H,2H2,1H3,(H,14,15,17) |
| InChIKey | NGROTRDSMKCSQQ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.36 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|