C13H8Cl2N2OS — CID 852970
2-(dichloromethyl)-5-phenyl-3H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 852970) has the molecular formula C13H8Cl2N2OS and a molecular weight of 311.19 g/mol. Its IUPAC name is 2-(dichloromethyl)-5-phenyl-3H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 2-(dichloromethyl)-5-phenyl-3H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 852970 |
| Molecular Formula | C13H8Cl2N2OS |
| Molecular Weight | 311.19 g/mol |
| Exact Mass | 309.97 |
| IUPAC Name | 2-(dichloromethyl)-5-phenyl-3H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(C(Cl)Cl)nc2scc(-c3ccccc3)c12 |
| InChI | InChI=1S/C13H8Cl2N2OS/c14-10(15)11-16-12(18)9-8(6-19-13(9)17-11)7-4-2-1-3-5-7/h1-6,10H,(H,16,17,18) |
| InChIKey | AJKBRUKJZJQOGQ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.19 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|