C27H22N2OS — CID 28868698
2-benzhydryl-5-(4-ethylphenyl)-3H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 28868698) has the molecular formula C27H22N2OS and a molecular weight of 422.55 g/mol. Its IUPAC name is 2-benzhydryl-5-(4-ethylphenyl)-3H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 2-benzhydryl-5-(4-ethylphenyl)-3H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 28868698 |
| Molecular Formula | C27H22N2OS |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | 2-benzhydryl-5-(4-ethylphenyl)-3H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | CCc1ccc(-c2csc3nc(C(c4ccccc4)c4ccccc4)[nH]c(=O)c23)cc1 |
| InChI | InChI=1S/C27H22N2OS/c1-2-18-13-15-19(16-14-18)22-17-31-27-24(22)26(30)28-25(29-27)23(20-9-5-3-6-10-20)21-11-7-4-8-12-21/h3-17,23H,2H2,1H3,(H,28,29,30) |
| InChIKey | YENHHETZJMRETH-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |