C22H20N2OS — CID 28890522
2-benzyl-5-(4-propan-2-ylphenyl)-3H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 28890522) has the molecular formula C22H20N2OS and a molecular weight of 360.48 g/mol. Its IUPAC name is 2-benzyl-5-(4-propan-2-ylphenyl)-3H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 2-benzyl-5-(4-propan-2-ylphenyl)-3H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 28890522 |
| Molecular Formula | C22H20N2OS |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | 2-benzyl-5-(4-propan-2-ylphenyl)-3H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | CC(C)c1ccc(-c2csc3nc(Cc4ccccc4)[nH]c(=O)c23)cc1 |
| InChI | InChI=1S/C22H20N2OS/c1-14(2)16-8-10-17(11-9-16)18-13-26-22-20(18)21(25)23-19(24-22)12-15-6-4-3-5-7-15/h3-11,13-14H,12H2,1-2H3,(H,23,24,25) |
| InChIKey | KDUVHOMKYYGWSM-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |