C23H20N2O3S — CID 7535943
(4-oxo-5-phenyl-3H-thieno[2,3-d]pyrimidin-2-yl)methyl (3S)-3-phenylbutanoate (PubChem CID 7535943) has the molecular formula C23H20N2O3S and a molecular weight of 404.49 g/mol. Its IUPAC name is (4-oxo-5-phenyl-3H-thieno[2,3-d]pyrimidin-2-yl)methyl (3S)-3-phenylbutanoate.
| Compound Name | (4-oxo-5-phenyl-3H-thieno[2,3-d]pyrimidin-2-yl)methyl (3S)-3-phenylbutanoate |
|---|---|
| PubChem CID | 7535943 |
| Molecular Formula | C23H20N2O3S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | (4-oxo-5-phenyl-3H-thieno[2,3-d]pyrimidin-2-yl)methyl (3S)-3-phenylbutanoate |
| SMILES | C[C@@H](CC(=O)OCc1nc2scc(-c3ccccc3)c2c(=O)[nH]1)c1ccccc1 |
| InChI | InChI=1S/C23H20N2O3S/c1-15(16-8-4-2-5-9-16)12-20(26)28-13-19-24-22(27)21-18(14-29-23(21)25-19)17-10-6-3-7-11-17/h2-11,14-15H,12-13H2,1H3,(H,24,25,27)/t15-/m0/s1 |
| InChIKey | NZDQCACOSJTZLK-HNNXBMFYSA-N |
| XLogP | 4.89 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |