C17H18N4O2S2 — CID 9179495
N',N'-dimethyl-2-[(4-oxo-5-phenyl-3H-thieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]acetohydrazide (PubChem CID 9179495) has the molecular formula C17H18N4O2S2 and a molecular weight of 374.49 g/mol. Its IUPAC name is N',N'-dimethyl-2-[(4-oxo-5-phenyl-3H-thieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]acetohydrazide.
| Compound Name | N',N'-dimethyl-2-[(4-oxo-5-phenyl-3H-thieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]acetohydrazide |
|---|---|
| PubChem CID | 9179495 |
| Molecular Formula | C17H18N4O2S2 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | N',N'-dimethyl-2-[(4-oxo-5-phenyl-3H-thieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]acetohydrazide |
| SMILES | CN(C)NC(=O)CSCc1nc2scc(-c3ccccc3)c2c(=O)[nH]1 |
| InChI | InChI=1S/C17H18N4O2S2/c1-21(2)20-14(22)10-24-9-13-18-16(23)15-12(8-25-17(15)19-13)11-6-4-3-5-7-11/h3-8H,9-10H2,1-2H3,(H,20,22)(H,18,19,23) |
| InChIKey | DJLQGYZYCZXYDD-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|