C16H16N4OS2 — CID 8866259
(4-oxo-5-phenyl-3H-thieno[2,3-d]pyrimidin-2-yl)methyl N,N'-dimethylcarbamimidothioate (PubChem CID 8866259) has the molecular formula C16H16N4OS2 and a molecular weight of 344.47 g/mol. Its IUPAC name is (4-oxo-5-phenyl-3H-thieno[2,3-d]pyrimidin-2-yl)methyl N,N'-dimethylcarbamimidothioate.
| Compound Name | (4-oxo-5-phenyl-3H-thieno[2,3-d]pyrimidin-2-yl)methyl N,N'-dimethylcarbamimidothioate |
|---|---|
| PubChem CID | 8866259 |
| Molecular Formula | C16H16N4OS2 |
| Molecular Weight | 344.47 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | (4-oxo-5-phenyl-3H-thieno[2,3-d]pyrimidin-2-yl)methyl N,N'-dimethylcarbamimidothioate |
| SMILES | C/N=C(\NC)SCc1nc2scc(-c3ccccc3)c2c(=O)[nH]1 |
| InChI | InChI=1S/C16H16N4OS2/c1-17-16(18-2)23-9-12-19-14(21)13-11(8-22-15(13)20-12)10-6-4-3-5-7-10/h3-8H,9H2,1-2H3,(H,17,18)(H,19,20,21) |
| InChIKey | GDSNFNYESKNAFB-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.47 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|