C19H13ClN2OS — CID 986669
2-[(4-chlorophenyl)methyl]-5-phenyl-3H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 986669) has the molecular formula C19H13ClN2OS and a molecular weight of 352.85 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methyl]-5-phenyl-3H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 2-[(4-chlorophenyl)methyl]-5-phenyl-3H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 986669 |
| Molecular Formula | C19H13ClN2OS |
| Molecular Weight | 352.85 g/mol |
| Exact Mass | 352.04 |
| IUPAC Name | 2-[(4-chlorophenyl)methyl]-5-phenyl-3H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(Cc2ccc(Cl)cc2)nc2scc(-c3ccccc3)c12 |
| InChI | InChI=1S/C19H13ClN2OS/c20-14-8-6-12(7-9-14)10-16-21-18(23)17-15(11-24-19(17)22-16)13-4-2-1-3-5-13/h1-9,11H,10H2,(H,21,22,23) |
| InChIKey | IVBDBKJBWLTWAE-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.85 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |