C20H17N3O2S — CID 11842406
2-[(4-methoxyanilino)methyl]-5-phenyl-3H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 11842406) has the molecular formula C20H17N3O2S and a molecular weight of 363.44 g/mol. Its IUPAC name is 2-[(4-methoxyanilino)methyl]-5-phenyl-3H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 2-[(4-methoxyanilino)methyl]-5-phenyl-3H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 11842406 |
| Molecular Formula | C20H17N3O2S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | 2-[(4-methoxyanilino)methyl]-5-phenyl-3H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | COc1ccc(NCc2nc3scc(-c4ccccc4)c3c(=O)[nH]2)cc1 |
| InChI | InChI=1S/C20H17N3O2S/c1-25-15-9-7-14(8-10-15)21-11-17-22-19(24)18-16(12-26-20(18)23-17)13-5-3-2-4-6-13/h2-10,12,21H,11H2,1H3,(H,22,23,24) |
| InChIKey | CETPUGKMLLVCEI-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|