C18H11ClN2OS — CID 28868492
2-(2-chlorophenyl)-5-phenyl-3H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 28868492) has the molecular formula C18H11ClN2OS and a molecular weight of 338.82 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-5-phenyl-3H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 2-(2-chlorophenyl)-5-phenyl-3H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 28868492 |
| Molecular Formula | C18H11ClN2OS |
| Molecular Weight | 338.82 g/mol |
| Exact Mass | 338.03 |
| IUPAC Name | 2-(2-chlorophenyl)-5-phenyl-3H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(-c2ccccc2Cl)nc2scc(-c3ccccc3)c12 |
| InChI | InChI=1S/C18H11ClN2OS/c19-14-9-5-4-8-12(14)16-20-17(22)15-13(10-23-18(15)21-16)11-6-2-1-3-7-11/h1-10H,(H,20,21,22) |
| InChIKey | FVNZPUMEZWHIDU-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.82 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |