C22H19BrN2O2S2 — CID 2118683
2-[(1S)-1-[2-(4-bromophenoxy)ethylsulfanyl]ethyl]-5-phenyl-3H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 2118683) has the molecular formula C22H19BrN2O2S2 and a molecular weight of 487.44 g/mol. Its IUPAC name is 2-[(1S)-1-[2-(4-bromophenoxy)ethylsulfanyl]ethyl]-5-phenyl-3H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 2-[(1S)-1-[2-(4-bromophenoxy)ethylsulfanyl]ethyl]-5-phenyl-3H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 2118683 |
| Molecular Formula | C22H19BrN2O2S2 |
| Molecular Weight | 487.44 g/mol |
| Exact Mass | 486.01 |
| IUPAC Name | 2-[(1S)-1-[2-(4-bromophenoxy)ethylsulfanyl]ethyl]-5-phenyl-3H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | C[C@H](SCCOc1ccc(Br)cc1)c1nc2scc(-c3ccccc3)c2c(=O)[nH]1 |
| InChI | InChI=1S/C22H19BrN2O2S2/c1-14(28-12-11-27-17-9-7-16(23)8-10-17)20-24-21(26)19-18(13-29-22(19)25-20)15-5-3-2-4-6-15/h2-10,13-14H,11-12H2,1H3,(H,24,25,26)/t14-/m0/s1 |
| InChIKey | BSMWRBFHZOCRRH-AWEZNQCLSA-N |
| XLogP | 6.29 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.44 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|