C19H19N3OS3 — CID 30064866
[(1R)-1-(4-oxo-5-phenyl-3H-thieno[2,3-d]pyrimidin-2-yl)ethyl] pyrrolidine-1-carbodithioate (PubChem CID 30064866) has the molecular formula C19H19N3OS3 and a molecular weight of 401.58 g/mol. Its IUPAC name is [(1R)-1-(4-oxo-5-phenyl-3H-thieno[2,3-d]pyrimidin-2-yl)ethyl] pyrrolidine-1-carbodithioate.
| Compound Name | [(1R)-1-(4-oxo-5-phenyl-3H-thieno[2,3-d]pyrimidin-2-yl)ethyl] pyrrolidine-1-carbodithioate |
|---|---|
| PubChem CID | 30064866 |
| Molecular Formula | C19H19N3OS3 |
| Molecular Weight | 401.58 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | [(1R)-1-(4-oxo-5-phenyl-3H-thieno[2,3-d]pyrimidin-2-yl)ethyl] pyrrolidine-1-carbodithioate |
| SMILES | C[C@@H](SC(=S)N1CCCC1)c1nc2scc(-c3ccccc3)c2c(=O)[nH]1 |
| InChI | InChI=1S/C19H19N3OS3/c1-12(26-19(24)22-9-5-6-10-22)16-20-17(23)15-14(11-25-18(15)21-16)13-7-3-2-4-8-13/h2-4,7-8,11-12H,5-6,9-10H2,1H3,(H,20,21,23)/t12-/m1/s1 |
| InChIKey | BURHLODVOIJISA-GFCCVEGCSA-N |
| XLogP | 4.83 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.58 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|