C15H17N3OS2 — CID 135803894
[(1R)-1-(4-oxo-3H-quinazolin-2-yl)ethyl] pyrrolidine-1-carbodithioate (PubChem CID 135803894) has the molecular formula C15H17N3OS2 and a molecular weight of 319.45 g/mol. Its IUPAC name is [(1R)-1-(4-oxo-3H-quinazolin-2-yl)ethyl] pyrrolidine-1-carbodithioate.
| Compound Name | [(1R)-1-(4-oxo-3H-quinazolin-2-yl)ethyl] pyrrolidine-1-carbodithioate |
|---|---|
| PubChem CID | 135803894 |
| Molecular Formula | C15H17N3OS2 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | [(1R)-1-(4-oxo-3H-quinazolin-2-yl)ethyl] pyrrolidine-1-carbodithioate |
| SMILES | C[C@@H](SC(=S)N1CCCC1)c1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C15H17N3OS2/c1-10(21-15(20)18-8-4-5-9-18)13-16-12-7-3-2-6-11(12)14(19)17-13/h2-3,6-7,10H,4-5,8-9H2,1H3,(H,16,17,19)/t10-/m1/s1 |
| InChIKey | AJKHHTFEGVQHEB-SNVBAGLBSA-N |
| XLogP | 3.10 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|