C14H10BrClN2OS — CID 43150223
5-(2-bromophenyl)-2-(1-chloroethyl)-3H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 43150223) has the molecular formula C14H10BrClN2OS and a molecular weight of 369.67 g/mol. Its IUPAC name is 5-(2-bromophenyl)-2-(1-chloroethyl)-3H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 5-(2-bromophenyl)-2-(1-chloroethyl)-3H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 43150223 |
| Molecular Formula | C14H10BrClN2OS |
| Molecular Weight | 369.67 g/mol |
| Exact Mass | 367.94 |
| IUPAC Name | 5-(2-bromophenyl)-2-(1-chloroethyl)-3H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | CC(Cl)c1nc2scc(-c3ccccc3Br)c2c(=O)[nH]1 |
| InChI | InChI=1S/C14H10BrClN2OS/c1-7(16)12-17-13(19)11-9(6-20-14(11)18-12)8-4-2-3-5-10(8)15/h2-7H,1H3,(H,17,18,19) |
| InChIKey | OXRCJTJAMDGDFI-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.67 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|