C15H12ClFN2OS — CID 114832502
2-(1-chloroethyl)-6-(2-fluorophenyl)-5-methyl-3H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 114832502) has the molecular formula C15H12ClFN2OS and a molecular weight of 322.79 g/mol. Its IUPAC name is 2-(1-chloroethyl)-6-(2-fluorophenyl)-5-methyl-3H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 2-(1-chloroethyl)-6-(2-fluorophenyl)-5-methyl-3H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 114832502 |
| Molecular Formula | C15H12ClFN2OS |
| Molecular Weight | 322.79 g/mol |
| Exact Mass | 322.03 |
| IUPAC Name | 2-(1-chloroethyl)-6-(2-fluorophenyl)-5-methyl-3H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | Cc1c(-c2ccccc2F)sc2nc(C(C)Cl)[nH]c(=O)c12 |
| InChI | InChI=1S/C15H12ClFN2OS/c1-7-11-14(20)18-13(8(2)16)19-15(11)21-12(7)9-5-3-4-6-10(9)17/h3-6,8H,1-2H3,(H,18,19,20) |
| InChIKey | RAVZVPRRLZACKE-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.79 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|