C20H15FN2OS — CID 167495691
2-benzyl-6-(4-fluorophenyl)-5-methyl-3H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 167495691) has the molecular formula C20H15FN2OS and a molecular weight of 350.42 g/mol. Its IUPAC name is 2-benzyl-6-(4-fluorophenyl)-5-methyl-3H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 2-benzyl-6-(4-fluorophenyl)-5-methyl-3H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 167495691 |
| Molecular Formula | C20H15FN2OS |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | 2-benzyl-6-(4-fluorophenyl)-5-methyl-3H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | Cc1c(-c2ccc(F)cc2)sc2nc(Cc3ccccc3)[nH]c(=O)c12 |
| InChI | InChI=1S/C20H15FN2OS/c1-12-17-19(24)22-16(11-13-5-3-2-4-6-13)23-20(17)25-18(12)14-7-9-15(21)10-8-14/h2-10H,11H2,1H3,(H,22,23,24) |
| InChIKey | USQCZIRCAZDWOM-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |