C14H11ClN2OS — CID 55025830
2-(chloromethyl)-5-methyl-6-phenyl-3H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 55025830) has the molecular formula C14H11ClN2OS and a molecular weight of 290.77 g/mol. Its IUPAC name is 2-(chloromethyl)-5-methyl-6-phenyl-3H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 2-(chloromethyl)-5-methyl-6-phenyl-3H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 55025830 |
| Molecular Formula | C14H11ClN2OS |
| Molecular Weight | 290.77 g/mol |
| Exact Mass | 290.03 |
| IUPAC Name | 2-(chloromethyl)-5-methyl-6-phenyl-3H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | Cc1c(-c2ccccc2)sc2nc(CCl)[nH]c(=O)c12 |
| InChI | InChI=1S/C14H11ClN2OS/c1-8-11-13(18)16-10(7-15)17-14(11)19-12(8)9-5-3-2-4-6-9/h2-6H,7H2,1H3,(H,16,17,18) |
| InChIKey | AFOZVXXSJZYKND-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.77 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|