C14H9N3OS — CID 58727424
6-isocyano-5-methyl-2-phenyl-3H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 58727424) has the molecular formula C14H9N3OS and a molecular weight of 267.31 g/mol. Its IUPAC name is 6-isocyano-5-methyl-2-phenyl-3H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 6-isocyano-5-methyl-2-phenyl-3H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 58727424 |
| Molecular Formula | C14H9N3OS |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.05 |
| IUPAC Name | 6-isocyano-5-methyl-2-phenyl-3H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | [C-]#[N+]c1sc2nc(-c3ccccc3)[nH]c(=O)c2c1C |
| InChI | InChI=1S/C14H9N3OS/c1-8-10-12(18)16-11(9-6-4-3-5-7-9)17-14(10)19-13(8)15-2/h3-7H,1H3,(H,16,17,18) |
| InChIKey | GYZPFWUQRLZLOH-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 50.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|