C19H16ClFN2O3S — CID 7542438
[(1S)-1-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)ethyl] (E)-3-(2-chloro-6-fluorophenyl)prop-2-enoate (PubChem CID 7542438) has the molecular formula C19H16ClFN2O3S and a molecular weight of 406.87 g/mol. Its IUPAC name is [(1S)-1-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)ethyl] (E)-3-(2-chloro-6-fluorophenyl)prop-2-enoate.
| Compound Name | [(1S)-1-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)ethyl] (E)-3-(2-chloro-6-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7542438 |
| Molecular Formula | C19H16ClFN2O3S |
| Molecular Weight | 406.87 g/mol |
| Exact Mass | 406.06 |
| IUPAC Name | [(1S)-1-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)ethyl] (E)-3-(2-chloro-6-fluorophenyl)prop-2-enoate |
| SMILES | Cc1sc2nc([C@H](C)OC(=O)/C=C/c3c(F)cccc3Cl)[nH]c(=O)c2c1C |
| InChI | InChI=1S/C19H16ClFN2O3S/c1-9-11(3)27-19-16(9)18(25)22-17(23-19)10(2)26-15(24)8-7-12-13(20)5-4-6-14(12)21/h4-8,10H,1-3H3,(H,22,23,25)/b8-7+/t10-/m0/s1 |
| InChIKey | OXPISOPKZJNIMB-JARNTUPDSA-N |
| XLogP | 4.71 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.87 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|