C14H16N2O3S — CID 7647995
[(1R)-1-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)ethyl] (E)-but-2-enoate (PubChem CID 7647995) has the molecular formula C14H16N2O3S and a molecular weight of 292.36 g/mol. Its IUPAC name is [(1R)-1-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)ethyl] (E)-but-2-enoate.
| Compound Name | [(1R)-1-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)ethyl] (E)-but-2-enoate |
|---|---|
| PubChem CID | 7647995 |
| Molecular Formula | C14H16N2O3S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | [(1R)-1-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)ethyl] (E)-but-2-enoate |
| SMILES | C/C=C/C(=O)O[C@H](C)c1nc2sc(C)c(C)c2c(=O)[nH]1 |
| InChI | InChI=1S/C14H16N2O3S/c1-5-6-10(17)19-8(3)12-15-13(18)11-7(2)9(4)20-14(11)16-12/h5-6,8H,1-4H3,(H,15,16,18)/b6-5+/t8-/m1/s1 |
| InChIKey | VOSIWQMOKDBQRG-HQZHTGGTSA-N |
| XLogP | 2.78 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|